C8H11NO2 — CID 10606954
(8S,8aS)-8-hydroxy-2,5,8,8a-tetrahydro-1H-indolizin-3-one (PubChem CID 10606954) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (8S,8aS)-8-hydroxy-2,5,8,8a-tetrahydro-1H-indolizin-3-one.
| Compound Name | (8S,8aS)-8-hydroxy-2,5,8,8a-tetrahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 10606954 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (8S,8aS)-8-hydroxy-2,5,8,8a-tetrahydro-1H-indolizin-3-one |
| SMILES | O=C1CC[C@H]2[C@@H](O)C=CCN12 |
| InChI | InChI=1S/C8H11NO2/c10-7-2-1-5-9-6(7)3-4-8(9)11/h1-2,6-7,10H,3-5H2/t6-,7-/m0/s1 |
| InChIKey | UBKCRQGYLOQTGQ-BQBZGAKWSA-N |
| XLogP | -0.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|