C9H13NO2 — CID 59052758
(9aS)-9-hydroxy-1,2,5,8,9,9a-hexahydropyrrolo[1,2-a]azepin-3-one (PubChem CID 59052758) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (9aS)-9-hydroxy-1,2,5,8,9,9a-hexahydropyrrolo[1,2-a]azepin-3-one.
| Compound Name | (9aS)-9-hydroxy-1,2,5,8,9,9a-hexahydropyrrolo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 59052758 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (9aS)-9-hydroxy-1,2,5,8,9,9a-hexahydropyrrolo[1,2-a]azepin-3-one |
| SMILES | O=C1CC[C@H]2C(O)CC=CCN12 |
| InChI | InChI=1S/C9H13NO2/c11-8-3-1-2-6-10-7(8)4-5-9(10)12/h1-2,7-8,11H,3-6H2/t7-,8?/m0/s1 |
| InChIKey | QSRUVMQRRPARGM-JAMMHHFISA-N |
| XLogP | 0.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|