C13H17ClN4O2S — CID 106070674
N-(2-chloro-6-methylphenyl)-5-methyl-4-(methylaminomethyl)-1H-pyrazole-3-sulfonamide (PubChem CID 106070674) has the molecular formula C13H17ClN4O2S and a molecular weight of 328.83 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-5-methyl-4-(methylaminomethyl)-1H-pyrazole-3-sulfonamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-5-methyl-4-(methylaminomethyl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106070674 |
| Molecular Formula | C13H17ClN4O2S |
| Molecular Weight | 328.83 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-5-methyl-4-(methylaminomethyl)-1H-pyrazole-3-sulfonamide |
| SMILES | CNCc1c(S(=O)(=O)Nc2c(C)cccc2Cl)n[nH]c1C |
| InChI | InChI=1S/C13H17ClN4O2S/c1-8-5-4-6-11(14)12(8)18-21(19,20)13-10(7-15-3)9(2)16-17-13/h4-6,15,18H,7H2,1-3H3,(H,16,17) |
| InChIKey | NFILQXYMUPDFPS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |