C11H20N4O2S — CID 106073619
2-(cyclopropylamino)-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanesulfonamide (PubChem CID 106073619) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanesulfonamide.
| Compound Name | 2-(cyclopropylamino)-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 106073619 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(cyclopropylamino)-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanesulfonamide |
| SMILES | Cn1cc(CCNS(=O)(=O)CCNC2CC2)cn1 |
| InChI | InChI=1S/C11H20N4O2S/c1-15-9-10(8-13-15)4-5-14-18(16,17)7-6-12-11-2-3-11/h8-9,11-12,14H,2-7H2,1H3 |
| InChIKey | CQGLKJVNGYYMKK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |