C14H22N2O2S2 — CID 106073676
3-(methylaminomethyl)-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide (PubChem CID 106073676) has the molecular formula C14H22N2O2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 3-(methylaminomethyl)-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-(methylaminomethyl)-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106073676 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-(methylaminomethyl)-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide |
| SMILES | CNCc1cccc(S(=O)(=O)NCC2(C)CCCS2)c1 |
| InChI | InChI=1S/C14H22N2O2S2/c1-14(7-4-8-19-14)11-16-20(17,18)13-6-3-5-12(9-13)10-15-2/h3,5-6,9,15-16H,4,7-8,10-11H2,1-2H3 |
| InChIKey | PXISZCUIADDOMY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |