C14H19NO3S2 — CID 80527077
3-acetyl-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide (PubChem CID 80527077) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 3-acetyl-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-acetyl-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 80527077 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-acetyl-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NCC2(C)CCCS2)c1 |
| InChI | InChI=1S/C14H19NO3S2/c1-11(16)12-5-3-6-13(9-12)20(17,18)15-10-14(2)7-4-8-19-14/h3,5-6,9,15H,4,7-8,10H2,1-2H3 |
| InChIKey | CMXQSYHOMBLTQB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |