C11H11F5N2O2S — CID 106074519
2-(cyclopropylamino)-N-(2,3,4,5,6-pentafluorophenyl)ethanesulfonamide (PubChem CID 106074519) has the molecular formula C11H11F5N2O2S and a molecular weight of 330.28 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-(2,3,4,5,6-pentafluorophenyl)ethanesulfonamide.
| Compound Name | 2-(cyclopropylamino)-N-(2,3,4,5,6-pentafluorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 106074519 |
| Molecular Formula | C11H11F5N2O2S |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-(cyclopropylamino)-N-(2,3,4,5,6-pentafluorophenyl)ethanesulfonamide |
| SMILES | O=S(=O)(CCNC1CC1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H11F5N2O2S/c12-6-7(13)9(15)11(10(16)8(6)14)18-21(19,20)4-3-17-5-1-2-5/h5,17-18H,1-4H2 |
| InChIKey | BJUMHISYCVVKPG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|