C13H22ClN3O3S — CID 106074909
5-chloro-2-methoxy-N',N'-dimethyl-3-[(propan-2-ylamino)methyl]benzenesulfonohydrazide (PubChem CID 106074909) has the molecular formula C13H22ClN3O3S and a molecular weight of 335.86 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N',N'-dimethyl-3-[(propan-2-ylamino)methyl]benzenesulfonohydrazide.
| Compound Name | 5-chloro-2-methoxy-N',N'-dimethyl-3-[(propan-2-ylamino)methyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 106074909 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-chloro-2-methoxy-N',N'-dimethyl-3-[(propan-2-ylamino)methyl]benzenesulfonohydrazide |
| SMILES | COc1c(CNC(C)C)cc(Cl)cc1S(=O)(=O)NN(C)C |
| InChI | InChI=1S/C13H22ClN3O3S/c1-9(2)15-8-10-6-11(14)7-12(13(10)20-5)21(18,19)16-17(3)4/h6-7,9,15-16H,8H2,1-5H3 |
| InChIKey | WKXLWICVQUTQMW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|