C12H14N2 — CID 10607601
4-(2,3-dimethylbut-3-en-2-yl)pyridine-2-carbonitrile (PubChem CID 10607601) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-(2,3-dimethylbut-3-en-2-yl)pyridine-2-carbonitrile.
| Compound Name | 4-(2,3-dimethylbut-3-en-2-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 10607601 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-(2,3-dimethylbut-3-en-2-yl)pyridine-2-carbonitrile |
| SMILES | C=C(C)C(C)(C)c1ccnc(C#N)c1 |
| InChI | InChI=1S/C12H14N2/c1-9(2)12(3,4)10-5-6-14-11(7-10)8-13/h5-7H,1H2,2-4H3 |
| InChIKey | QNJJEHWYYAAKQA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|