C14H26N4O2S — CID 106076678
4-(methylaminomethyl)-N-(2-propan-2-ylcyclohexyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106076678) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is 4-(methylaminomethyl)-N-(2-propan-2-ylcyclohexyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(methylaminomethyl)-N-(2-propan-2-ylcyclohexyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106076678 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 4-(methylaminomethyl)-N-(2-propan-2-ylcyclohexyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CNCc1cn[nH]c1S(=O)(=O)NC1CCCCC1C(C)C |
| InChI | InChI=1S/C14H26N4O2S/c1-10(2)12-6-4-5-7-13(12)18-21(19,20)14-11(8-15-3)9-16-17-14/h9-10,12-13,15,18H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | ZOJGHTHBBNDTJM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |