C12H14BrN3O2S2 — CID 106076817
5-(aminomethyl)-N-(5-bromo-3-methyl-2-pyridinyl)-4-methylthiophene-2-sulfonamide (PubChem CID 106076817) has the molecular formula C12H14BrN3O2S2 and a molecular weight of 376.30 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(5-bromo-3-methyl-2-pyridinyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(5-bromo-3-methyl-2-pyridinyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106076817 |
| Molecular Formula | C12H14BrN3O2S2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 5-(aminomethyl)-N-(5-bromo-3-methyl-2-pyridinyl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(Br)cnc1NS(=O)(=O)c1cc(C)c(CN)s1 |
| InChI | InChI=1S/C12H14BrN3O2S2/c1-7-4-11(19-10(7)5-14)20(17,18)16-12-8(2)3-9(13)6-15-12/h3-4,6H,5,14H2,1-2H3,(H,15,16) |
| InChIKey | ZELHDKDTUCYLMA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |