C11H11Br2N3O2S2 — CID 106076839
5-(aminomethyl)-2-bromo-N-(5-bromo-3-methyl-2-pyridinyl)thiophene-3-sulfonamide (PubChem CID 106076839) has the molecular formula C11H11Br2N3O2S2 and a molecular weight of 441.17 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(5-bromo-3-methyl-2-pyridinyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(5-bromo-3-methyl-2-pyridinyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106076839 |
| Molecular Formula | C11H11Br2N3O2S2 |
| Molecular Weight | 441.17 g/mol |
| Exact Mass | 438.87 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(5-bromo-3-methyl-2-pyridinyl)thiophene-3-sulfonamide |
| SMILES | Cc1cc(Br)cnc1NS(=O)(=O)c1cc(CN)sc1Br |
| InChI | InChI=1S/C11H11Br2N3O2S2/c1-6-2-7(12)5-15-11(6)16-20(17,18)9-3-8(4-14)19-10(9)13/h2-3,5H,4,14H2,1H3,(H,15,16) |
| InChIKey | DDRGDXWJCKUANV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |