C14H31N3O2S2 — CID 106078191
N-(4-methylsulfanylbutyl)-2-[(propan-2-ylamino)methyl]piperidine-1-sulfonamide (PubChem CID 106078191) has the molecular formula C14H31N3O2S2 and a molecular weight of 337.56 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)-2-[(propan-2-ylamino)methyl]piperidine-1-sulfonamide.
| Compound Name | N-(4-methylsulfanylbutyl)-2-[(propan-2-ylamino)methyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106078191 |
| Molecular Formula | C14H31N3O2S2 |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-(4-methylsulfanylbutyl)-2-[(propan-2-ylamino)methyl]piperidine-1-sulfonamide |
| SMILES | CSCCCCNS(=O)(=O)N1CCCCC1CNC(C)C |
| InChI | InChI=1S/C14H31N3O2S2/c1-13(2)15-12-14-8-4-6-10-17(14)21(18,19)16-9-5-7-11-20-3/h13-16H,4-12H2,1-3H3 |
| InChIKey | OTCXGBLTBTUMFM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|