C15H20 — CID 10608109
3,11-dimethylidenetrideca-1,12-diyne (PubChem CID 10608109) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3,11-dimethylidenetrideca-1,12-diyne.
| Compound Name | 3,11-dimethylidenetrideca-1,12-diyne |
|---|---|
| PubChem CID | 10608109 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 3,11-dimethylidenetrideca-1,12-diyne |
| SMILES | C#CC(=C)CCCCCCCC(=C)C#C |
| InChI | InChI=1S/C15H20/c1-5-14(3)12-10-8-7-9-11-13-15(4)6-2/h1-2H,3-4,7-13H2 |
| InChIKey | VWZMWDCXJVNVFR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|