About 7-methylideneundec-5-yne
7-methylideneundec-5-yne (PubChem CID 10866683) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 7-methylideneundec-5-yne.
Molecular Properties
| Compound Name | 7-methylideneundec-5-yne |
| PubChem CID | 10866683 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 7-methylideneundec-5-yne |
| SMILES | C=C(C#CCCCC)CCCC |
| InChI | InChI=1S/C12H20/c1-4-6-8-9-11-12(3)10-7-5-2/h3-8,10H2,1-2H3 |
| InChIKey | XLJGLSFHSZISSS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methylideneundec-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylideneundec-5-yne?
The IUPAC name of 7-methylideneundec-5-yne (CID 10866683) is 7-methylideneundec-5-yne.
What is the SMILES notation for 7-methylideneundec-5-yne?
The canonical SMILES for 7-methylideneundec-5-yne is C=C(C#CCCCC)CCCC.
What is the InChIKey of 7-methylideneundec-5-yne?
The InChIKey is XLJGLSFHSZISSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-4-6-8-9-11-12(3)10-7-5-2/h3-8,10H2,1-2H3.
What are the key properties of 7-methylideneundec-5-yne?
7-methylideneundec-5-yne has a molecular weight of 164.29 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylideneundec-5-yne is sourced from PubChem (CID 10866683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).