C13H18F2N2O2S2 — CID 106086315
3-(ethylaminomethyl)-2,4-difluoro-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 106086315) has the molecular formula C13H18F2N2O2S2 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-2,4-difluoro-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 3-(ethylaminomethyl)-2,4-difluoro-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106086315 |
| Molecular Formula | C13H18F2N2O2S2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-(ethylaminomethyl)-2,4-difluoro-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | CCNCc1c(F)ccc(S(=O)(=O)NC2CCSC2)c1F |
| InChI | InChI=1S/C13H18F2N2O2S2/c1-2-16-7-10-11(14)3-4-12(13(10)15)21(18,19)17-9-5-6-20-8-9/h3-4,9,16-17H,2,5-8H2,1H3 |
| InChIKey | UZOVPJJJXZPLEE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |