C12H13F2NO3S — CID 70931231
N-cyclopropyl-2,4-difluoro-3-propanoylbenzenesulfonamide (PubChem CID 70931231) has the molecular formula C12H13F2NO3S and a molecular weight of 289.30 g/mol. Its IUPAC name is N-cyclopropyl-2,4-difluoro-3-propanoylbenzenesulfonamide.
| Compound Name | N-cyclopropyl-2,4-difluoro-3-propanoylbenzenesulfonamide |
|---|---|
| PubChem CID | 70931231 |
| Molecular Formula | C12H13F2NO3S |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-cyclopropyl-2,4-difluoro-3-propanoylbenzenesulfonamide |
| SMILES | CCC(=O)c1c(F)ccc(S(=O)(=O)NC2CC2)c1F |
| InChI | InChI=1S/C12H13F2NO3S/c1-2-9(16)11-8(13)5-6-10(12(11)14)19(17,18)15-7-3-4-7/h5-7,15H,2-4H2,1H3 |
| InChIKey | JWELRYMQOYQQPL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |