C10H12F2N2O3S — CID 107343661
3-amino-2,4-difluoro-N-(3-hydroxycyclobutyl)benzenesulfonamide (PubChem CID 107343661) has the molecular formula C10H12F2N2O3S and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-(3-hydroxycyclobutyl)benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-(3-hydroxycyclobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107343661 |
| Molecular Formula | C10H12F2N2O3S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 3-amino-2,4-difluoro-N-(3-hydroxycyclobutyl)benzenesulfonamide |
| SMILES | Nc1c(F)ccc(S(=O)(=O)NC2CC(O)C2)c1F |
| InChI | InChI=1S/C10H12F2N2O3S/c11-7-1-2-8(9(12)10(7)13)18(16,17)14-5-3-6(15)4-5/h1-2,5-6,14-15H,3-4,13H2 |
| InChIKey | YSGKWWLZZDZJQP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|