C10H12ClFN2O3S — CID 103051713
3-amino-5-chloro-2-fluoro-N-(3-hydroxycyclobutyl)benzenesulfonamide (PubChem CID 103051713) has the molecular formula C10H12ClFN2O3S and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-amino-5-chloro-2-fluoro-N-(3-hydroxycyclobutyl)benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-2-fluoro-N-(3-hydroxycyclobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103051713 |
| Molecular Formula | C10H12ClFN2O3S |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 3-amino-5-chloro-2-fluoro-N-(3-hydroxycyclobutyl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)NC2CC(O)C2)c1F |
| InChI | InChI=1S/C10H12ClFN2O3S/c11-5-1-8(13)10(12)9(2-5)18(16,17)14-6-3-7(15)4-6/h1-2,6-7,14-15H,3-4,13H2 |
| InChIKey | CXKYSBUJVMAYQN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|