C12H19ClN4O2S — CID 106086534
3-chloro-2-[[3-(cyclopropylamino)propyl-methylsulfamoyl]amino]pyridine (PubChem CID 106086534) has the molecular formula C12H19ClN4O2S and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-chloro-2-[[3-(cyclopropylamino)propyl-methylsulfamoyl]amino]pyridine.
| Compound Name | 3-chloro-2-[[3-(cyclopropylamino)propyl-methylsulfamoyl]amino]pyridine |
|---|---|
| PubChem CID | 106086534 |
| Molecular Formula | C12H19ClN4O2S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 3-chloro-2-[[3-(cyclopropylamino)propyl-methylsulfamoyl]amino]pyridine |
| SMILES | CN(CCCNC1CC1)S(=O)(=O)Nc1ncccc1Cl |
| InChI | InChI=1S/C12H19ClN4O2S/c1-17(9-3-8-14-10-5-6-10)20(18,19)16-12-11(13)4-2-7-15-12/h2,4,7,10,14H,3,5-6,8-9H2,1H3,(H,15,16) |
| InChIKey | OSFBXVABFCFSTB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|