C14H18N4O2S — CID 106088550
4-[3-(methylamino)propyl]-N-pyrimidin-5-ylbenzenesulfonamide (PubChem CID 106088550) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-[3-(methylamino)propyl]-N-pyrimidin-5-ylbenzenesulfonamide.
| Compound Name | 4-[3-(methylamino)propyl]-N-pyrimidin-5-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106088550 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-[3-(methylamino)propyl]-N-pyrimidin-5-ylbenzenesulfonamide |
| SMILES | CNCCCc1ccc(S(=O)(=O)Nc2cncnc2)cc1 |
| InChI | InChI=1S/C14H18N4O2S/c1-15-8-2-3-12-4-6-14(7-5-12)21(19,20)18-13-9-16-11-17-10-13/h4-7,9-11,15,18H,2-3,8H2,1H3 |
| InChIKey | UCTUIDWPMFNATF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|