C16H28N2O2S — CID 106018766
4-[3-(methylamino)propyl]-N-(2-methylpentan-3-yl)benzenesulfonamide (PubChem CID 106018766) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 4-[3-(methylamino)propyl]-N-(2-methylpentan-3-yl)benzenesulfonamide.
| Compound Name | 4-[3-(methylamino)propyl]-N-(2-methylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106018766 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 4-[3-(methylamino)propyl]-N-(2-methylpentan-3-yl)benzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(CCCNC)cc1)C(C)C |
| InChI | InChI=1S/C16H28N2O2S/c1-5-16(13(2)3)18-21(19,20)15-10-8-14(9-11-15)7-6-12-17-4/h8-11,13,16-18H,5-7,12H2,1-4H3 |
| InChIKey | YHZHMGKVTMJSRC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|