C11H10ClFN4O2S — CID 106088755
3-(aminomethyl)-4-chloro-5-fluoro-N-pyrimidin-5-ylbenzenesulfonamide (PubChem CID 106088755) has the molecular formula C11H10ClFN4O2S and a molecular weight of 316.75 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-5-fluoro-N-pyrimidin-5-ylbenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-chloro-5-fluoro-N-pyrimidin-5-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106088755 |
| Molecular Formula | C11H10ClFN4O2S |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-5-fluoro-N-pyrimidin-5-ylbenzenesulfonamide |
| SMILES | NCc1cc(S(=O)(=O)Nc2cncnc2)cc(F)c1Cl |
| InChI | InChI=1S/C11H10ClFN4O2S/c12-11-7(3-14)1-9(2-10(11)13)20(18,19)17-8-4-15-6-16-5-8/h1-2,4-6,17H,3,14H2 |
| InChIKey | QXABHZYWTZJGHS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |