C9H11ClF2N2O2S — CID 114267220
3-(aminomethyl)-4-chloro-5-fluoro-N-(2-fluoroethyl)benzenesulfonamide (PubChem CID 114267220) has the molecular formula C9H11ClF2N2O2S and a molecular weight of 284.72 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-fluoroethyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-fluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114267220 |
| Molecular Formula | C9H11ClF2N2O2S |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-fluoroethyl)benzenesulfonamide |
| SMILES | NCc1cc(S(=O)(=O)NCCF)cc(F)c1Cl |
| InChI | InChI=1S/C9H11ClF2N2O2S/c10-9-6(5-13)3-7(4-8(9)12)17(15,16)14-2-1-11/h3-4,14H,1-2,5,13H2 |
| InChIKey | SBCNZEGLXWJBMN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |