C10H14ClFN2O3S — CID 81457810
3-(aminomethyl)-4-chloro-5-fluoro-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 81457810) has the molecular formula C10H14ClFN2O3S and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81457810 |
| Molecular Formula | C10H14ClFN2O3S |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(F)c(Cl)c(CN)c1 |
| InChI | InChI=1S/C10H14ClFN2O3S/c1-17-3-2-14-18(15,16)8-4-7(6-13)10(11)9(12)5-8/h4-5,14H,2-3,6,13H2,1H3 |
| InChIKey | GERLPWFMWZDNEA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|