C11H16ClFN2O3S — CID 81457692
3-(aminomethyl)-4-chloro-5-fluoro-N-(2-methoxyethyl)-N-methylbenzenesulfonamide (PubChem CID 81457692) has the molecular formula C11H16ClFN2O3S and a molecular weight of 310.78 g/mol. Its IUPAC name is 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-methoxyethyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-methoxyethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81457692 |
| Molecular Formula | C11H16ClFN2O3S |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-(aminomethyl)-4-chloro-5-fluoro-N-(2-methoxyethyl)-N-methylbenzenesulfonamide |
| SMILES | COCCN(C)S(=O)(=O)c1cc(F)c(Cl)c(CN)c1 |
| InChI | InChI=1S/C11H16ClFN2O3S/c1-15(3-4-18-2)19(16,17)9-5-8(7-14)11(12)10(13)6-9/h5-6H,3-4,7,14H2,1-2H3 |
| InChIKey | UVKCGRWAFCQYHI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |