C15H27N3O2S — CID 106091263
N-(2-cyclopropylpropan-2-yl)-5-(methylaminomethyl)-1-propan-2-ylpyrrole-3-sulfonamide (PubChem CID 106091263) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N-(2-cyclopropylpropan-2-yl)-5-(methylaminomethyl)-1-propan-2-ylpyrrole-3-sulfonamide.
| Compound Name | N-(2-cyclopropylpropan-2-yl)-5-(methylaminomethyl)-1-propan-2-ylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106091263 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(2-cyclopropylpropan-2-yl)-5-(methylaminomethyl)-1-propan-2-ylpyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NC(C)(C)C2CC2)cn1C(C)C |
| InChI | InChI=1S/C15H27N3O2S/c1-11(2)18-10-14(8-13(18)9-16-5)21(19,20)17-15(3,4)12-6-7-12/h8,10-12,16-17H,6-7,9H2,1-5H3 |
| InChIKey | RUVDFTKKKAPQHT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |