C11H18F2N2O3S2 — CID 106091837
N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-2-(methylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106091837) has the molecular formula C11H18F2N2O3S2 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-2-(methylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-2-(methylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106091837 |
| Molecular Formula | C11H18F2N2O3S2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-2-(methylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CNCc1scc(C)c1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C11H18F2N2O3S2/c1-8-7-19-9(5-14-2)11(8)20(16,17)15-3-4-18-6-10(12)13/h7,10,14-15H,3-6H2,1-2H3 |
| InChIKey | QLBLFQUAMQOLRP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|