C12H20F2N2O3S2 — CID 106091838
N-[2-(2,2-difluoroethoxy)ethyl]-2-(ethylaminomethyl)-4-methylthiophene-3-sulfonamide (PubChem CID 106091838) has the molecular formula C12H20F2N2O3S2 and a molecular weight of 342.43 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-2-(ethylaminomethyl)-4-methylthiophene-3-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(ethylaminomethyl)-4-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106091838 |
| Molecular Formula | C12H20F2N2O3S2 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(ethylaminomethyl)-4-methylthiophene-3-sulfonamide |
| SMILES | CCNCc1scc(C)c1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C12H20F2N2O3S2/c1-3-15-6-10-12(9(2)8-20-10)21(17,18)16-4-5-19-7-11(13)14/h8,11,15-16H,3-7H2,1-2H3 |
| InChIKey | OZFHIJJKFHYEBL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|