C14H22N4O2 — CID 106095375
5-amino-N-(4-amino-2-methyl-4-oxobutan-2-yl)-2-(dimethylamino)benzamide (PubChem CID 106095375) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 5-amino-N-(4-amino-2-methyl-4-oxobutan-2-yl)-2-(dimethylamino)benzamide.
| Compound Name | 5-amino-N-(4-amino-2-methyl-4-oxobutan-2-yl)-2-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 106095375 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 5-amino-N-(4-amino-2-methyl-4-oxobutan-2-yl)-2-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(N)cc1C(=O)NC(C)(C)CC(N)=O |
| InChI | InChI=1S/C14H22N4O2/c1-14(2,8-12(16)19)17-13(20)10-7-9(15)5-6-11(10)18(3)4/h5-7H,8,15H2,1-4H3,(H2,16,19)(H,17,20) |
| InChIKey | WGABBUSCNSNNFD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|