C12H18N4O2 — CID 106095327
5-amino-N-(4-amino-2-methyl-4-oxobutan-2-yl)-2-methylpyridine-3-carboxamide (PubChem CID 106095327) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-amino-N-(4-amino-2-methyl-4-oxobutan-2-yl)-2-methylpyridine-3-carboxamide.
| Compound Name | 5-amino-N-(4-amino-2-methyl-4-oxobutan-2-yl)-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 106095327 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 5-amino-N-(4-amino-2-methyl-4-oxobutan-2-yl)-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncc(N)cc1C(=O)NC(C)(C)CC(N)=O |
| InChI | InChI=1S/C12H18N4O2/c1-7-9(4-8(13)6-15-7)11(18)16-12(2,3)5-10(14)17/h4,6H,5,13H2,1-3H3,(H2,14,17)(H,16,18) |
| InChIKey | ZMOUBAZEHINMKU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |