C10H21N3O2 — CID 106096139
3-(butylcarbamoylamino)-3-methylbutanamide (PubChem CID 106096139) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(butylcarbamoylamino)-3-methylbutanamide.
| Compound Name | 3-(butylcarbamoylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 106096139 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 3-(butylcarbamoylamino)-3-methylbutanamide |
| SMILES | CCCCNC(=O)NC(C)(C)CC(N)=O |
| InChI | InChI=1S/C10H21N3O2/c1-4-5-6-12-9(15)13-10(2,3)7-8(11)14/h4-7H2,1-3H3,(H2,11,14)(H2,12,13,15) |
| InChIKey | DOMMCCKGHMOKLP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|