C12H19N5OS — CID 106097489
3-(3-ethyl-1-methyl-5-sulfanylidene-4H-imidazo[4,5-d]pyrazol-6-yl)-3-methylbutanamide (PubChem CID 106097489) has the molecular formula C12H19N5OS and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-(3-ethyl-1-methyl-5-sulfanylidene-4H-imidazo[4,5-d]pyrazol-6-yl)-3-methylbutanamide.
| Compound Name | 3-(3-ethyl-1-methyl-5-sulfanylidene-4H-imidazo[4,5-d]pyrazol-6-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 106097489 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-(3-ethyl-1-methyl-5-sulfanylidene-4H-imidazo[4,5-d]pyrazol-6-yl)-3-methylbutanamide |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2C(C)(C)CC(N)=O |
| InChI | InChI=1S/C12H19N5OS/c1-5-7-9-10(16(4)15-7)17(11(19)14-9)12(2,3)6-8(13)18/h5-6H2,1-4H3,(H2,13,18)(H,14,19) |
| InChIKey | KGYDEODBIARWHV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|