C14H19ClN4O — CID 106097658
3-[2-(1-chloroethyl)-7-methylimidazo[4,5-b]pyridin-3-yl]-3-methylbutanamide (PubChem CID 106097658) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 3-[2-(1-chloroethyl)-7-methylimidazo[4,5-b]pyridin-3-yl]-3-methylbutanamide.
| Compound Name | 3-[2-(1-chloroethyl)-7-methylimidazo[4,5-b]pyridin-3-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106097658 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-[2-(1-chloroethyl)-7-methylimidazo[4,5-b]pyridin-3-yl]-3-methylbutanamide |
| SMILES | Cc1ccnc2c1nc(C(C)Cl)n2C(C)(C)CC(N)=O |
| InChI | InChI=1S/C14H19ClN4O/c1-8-5-6-17-13-11(8)18-12(9(2)15)19(13)14(3,4)7-10(16)20/h5-6,9H,7H2,1-4H3,(H2,16,20) |
| InChIKey | VEGYCTBLIBTKMU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|