C11H13ClN4O — CID 79293274
2-[2-(1-chloroethyl)-7-methylimidazo[4,5-b]pyridin-3-yl]acetamide (PubChem CID 79293274) has the molecular formula C11H13ClN4O and a molecular weight of 252.71 g/mol. Its IUPAC name is 2-[2-(1-chloroethyl)-7-methylimidazo[4,5-b]pyridin-3-yl]acetamide.
| Compound Name | 2-[2-(1-chloroethyl)-7-methylimidazo[4,5-b]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 79293274 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[2-(1-chloroethyl)-7-methylimidazo[4,5-b]pyridin-3-yl]acetamide |
| SMILES | Cc1ccnc2c1nc(C(C)Cl)n2CC(N)=O |
| InChI | InChI=1S/C11H13ClN4O/c1-6-3-4-14-11-9(6)15-10(7(2)12)16(11)5-8(13)17/h3-4,7H,5H2,1-2H3,(H2,13,17) |
| InChIKey | ACGSTIXVEVGPCQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|