C12H16N4O2 — CID 106099685
3-amino-2-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]pyridine-4-carbonitrile (PubChem CID 106099685) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-amino-2-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 106099685 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-amino-2-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]pyridine-4-carbonitrile |
| SMILES | CC1OCCC1(O)CNc1nccc(C#N)c1N |
| InChI | InChI=1S/C12H16N4O2/c1-8-12(17,3-5-18-8)7-16-11-10(14)9(6-13)2-4-15-11/h2,4,8,17H,3,5,7,14H2,1H3,(H,15,16) |
| InChIKey | DEDDRNOTNFMNPM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |