C10H15N5O4 — CID 106103547
3-[[(6-amino-5-nitropyrimidin-4-yl)amino]methyl]-2-methyloxolan-3-ol (PubChem CID 106103547) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 3-[[(6-amino-5-nitropyrimidin-4-yl)amino]methyl]-2-methyloxolan-3-ol.
| Compound Name | 3-[[(6-amino-5-nitropyrimidin-4-yl)amino]methyl]-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 106103547 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 3-[[(6-amino-5-nitropyrimidin-4-yl)amino]methyl]-2-methyloxolan-3-ol |
| SMILES | CC1OCCC1(O)CNc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N5O4/c1-6-10(16,2-3-19-6)4-12-9-7(15(17)18)8(11)13-5-14-9/h5-6,16H,2-4H2,1H3,(H3,11,12,13,14) |
| InChIKey | YILHNOMVRRZUDU-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|