C9H16N2O2 — CID 106100551
3-[(3,4-dihydro-2H-pyrrol-5-ylamino)methyl]oxolan-3-ol (PubChem CID 106100551) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-[(3,4-dihydro-2H-pyrrol-5-ylamino)methyl]oxolan-3-ol.
| Compound Name | 3-[(3,4-dihydro-2H-pyrrol-5-ylamino)methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 106100551 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-[(3,4-dihydro-2H-pyrrol-5-ylamino)methyl]oxolan-3-ol |
| SMILES | OC1(CNC2=NCCC2)CCOC1 |
| InChI | InChI=1S/C9H16N2O2/c12-9(3-5-13-7-9)6-11-8-2-1-4-10-8/h12H,1-7H2,(H,10,11) |
| InChIKey | VNCQFQDBAGOEIC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |