C8H17N3O3 — CID 106101826
N'-hydroxy-3-[(3-hydroxyoxolan-3-yl)methylamino]propanimidamide (PubChem CID 106101826) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is N'-hydroxy-3-[(3-hydroxyoxolan-3-yl)methylamino]propanimidamide.
| Compound Name | N'-hydroxy-3-[(3-hydroxyoxolan-3-yl)methylamino]propanimidamide |
|---|---|
| PubChem CID | 106101826 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N'-hydroxy-3-[(3-hydroxyoxolan-3-yl)methylamino]propanimidamide |
| SMILES | NC(CCNCC1(O)CCOC1)=NO |
| InChI | InChI=1S/C8H17N3O3/c9-7(11-13)1-3-10-5-8(12)2-4-14-6-8/h10,12-13H,1-6H2,(H2,9,11) |
| InChIKey | GAKAJRPYOCGCJZ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|