C9H18N2O3 — CID 106100669
3-[(3-hydroxyoxolan-3-yl)methylamino]-N-methylpropanamide (PubChem CID 106100669) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-[(3-hydroxyoxolan-3-yl)methylamino]-N-methylpropanamide.
| Compound Name | 3-[(3-hydroxyoxolan-3-yl)methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106100669 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 3-[(3-hydroxyoxolan-3-yl)methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNCC1(O)CCOC1 |
| InChI | InChI=1S/C9H18N2O3/c1-10-8(12)2-4-11-6-9(13)3-5-14-7-9/h11,13H,2-7H2,1H3,(H,10,12) |
| InChIKey | IEZIGNSQLQOYRN-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|