C11H20N2O4 — CID 106101637
4-hydroxy-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]pyrrolidine-2-carboxamide (PubChem CID 106101637) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-hydroxy-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106101637 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 4-hydroxy-N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]pyrrolidine-2-carboxamide |
| SMILES | CC1OCCC1(O)CNC(=O)C1CC(O)CN1 |
| InChI | InChI=1S/C11H20N2O4/c1-7-11(16,2-3-17-7)6-13-10(15)9-4-8(14)5-12-9/h7-9,12,14,16H,2-6H2,1H3,(H,13,15) |
| InChIKey | MNDCHNZBLKQRAN-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |