C13H27N3O3 — CID 106101869
N'-hydroxy-5-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2,2-dimethylpentanimidamide (PubChem CID 106101869) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is N'-hydroxy-5-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2,2-dimethylpentanimidamide.
| Compound Name | N'-hydroxy-5-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 106101869 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N'-hydroxy-5-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2,2-dimethylpentanimidamide |
| SMILES | CC1OCCC1(O)CNCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C13H27N3O3/c1-10-13(17,6-8-19-10)9-15-7-4-5-12(2,3)11(14)16-18/h10,15,17-18H,4-9H2,1-3H3,(H2,14,16) |
| InChIKey | FFVHAUQXFJEULK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|