C13H21N3O3 — CID 106102253
2-methyl-3-[[(4-propan-2-yloxypyrimidin-2-yl)amino]methyl]oxolan-3-ol (PubChem CID 106102253) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-methyl-3-[[(4-propan-2-yloxypyrimidin-2-yl)amino]methyl]oxolan-3-ol.
| Compound Name | 2-methyl-3-[[(4-propan-2-yloxypyrimidin-2-yl)amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 106102253 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-methyl-3-[[(4-propan-2-yloxypyrimidin-2-yl)amino]methyl]oxolan-3-ol |
| SMILES | CC(C)Oc1ccnc(NCC2(O)CCOC2C)n1 |
| InChI | InChI=1S/C13H21N3O3/c1-9(2)19-11-4-6-14-12(16-11)15-8-13(17)5-7-18-10(13)3/h4,6,9-10,17H,5,7-8H2,1-3H3,(H,14,15,16) |
| InChIKey | LKWSYTWIYRMPPS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |