C13H21N3O3 — CID 104762705
N-[(3-methoxyoxolan-3-yl)methyl]-4-propan-2-yloxypyrimidin-2-amine (PubChem CID 104762705) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(3-methoxyoxolan-3-yl)methyl]-4-propan-2-yloxypyrimidin-2-amine.
| Compound Name | N-[(3-methoxyoxolan-3-yl)methyl]-4-propan-2-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 104762705 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[(3-methoxyoxolan-3-yl)methyl]-4-propan-2-yloxypyrimidin-2-amine |
| SMILES | COC1(CNc2nccc(OC(C)C)n2)CCOC1 |
| InChI | InChI=1S/C13H21N3O3/c1-10(2)19-11-4-6-14-12(16-11)15-8-13(17-3)5-7-18-9-13/h4,6,10H,5,7-9H2,1-3H3,(H,14,15,16) |
| InChIKey | LLANGBLGUJESQZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |