C9H5N7O2 — CID 10610227
3-(3-nitro-2-pyridinyl)triazolo[4,5-c]pyridazine (PubChem CID 10610227) has the molecular formula C9H5N7O2 and a molecular weight of 243.19 g/mol. Its IUPAC name is 3-(3-nitro-2-pyridinyl)triazolo[4,5-c]pyridazine.
| Compound Name | 3-(3-nitro-2-pyridinyl)triazolo[4,5-c]pyridazine |
|---|---|
| PubChem CID | 10610227 |
| Molecular Formula | C9H5N7O2 |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3-(3-nitro-2-pyridinyl)triazolo[4,5-c]pyridazine |
| SMILES | O=[N+]([O-])c1cccnc1-n1nnc2ccnnc21 |
| InChI | InChI=1S/C9H5N7O2/c17-16(18)7-2-1-4-10-9(7)15-8-6(12-14-15)3-5-11-13-8/h1-5H |
| InChIKey | XCQNIZBLADZOSG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|