C13H20ClN3O3 — CID 106102296
4-chloro-5-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2-propan-2-ylpyridazin-3-one (PubChem CID 106102296) has the molecular formula C13H20ClN3O3 and a molecular weight of 301.77 g/mol. Its IUPAC name is 4-chloro-5-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2-propan-2-ylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 106102296 |
| Molecular Formula | C13H20ClN3O3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-chloro-5-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]-2-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)n1ncc(NCC2(O)CCOC2C)c(Cl)c1=O |
| InChI | InChI=1S/C13H20ClN3O3/c1-8(2)17-12(18)11(14)10(6-16-17)15-7-13(19)4-5-20-9(13)3/h6,8-9,15,19H,4-5,7H2,1-3H3 |
| InChIKey | YJKFLKYFRRMHEL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |