C13H20N4O4 — CID 106105976
2-[4-[2-(1-methylpyrazol-3-yl)ethylcarbamoyl]morpholin-2-yl]acetic acid (PubChem CID 106105976) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[4-[2-(1-methylpyrazol-3-yl)ethylcarbamoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[2-(1-methylpyrazol-3-yl)ethylcarbamoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 106105976 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[4-[2-(1-methylpyrazol-3-yl)ethylcarbamoyl]morpholin-2-yl]acetic acid |
| SMILES | Cn1ccc(CCNC(=O)N2CCOC(CC(=O)O)C2)n1 |
| InChI | InChI=1S/C13H20N4O4/c1-16-5-3-10(15-16)2-4-14-13(20)17-6-7-21-11(9-17)8-12(18)19/h3,5,11H,2,4,6-9H2,1H3,(H,14,20)(H,18,19) |
| InChIKey | ANXDGEHKTRVKHF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |