C13H25N5O2S — CID 106106639
4-(methylaminomethyl)-N-[2-(1-methylpyrazol-3-yl)ethyl]piperidine-1-sulfonamide (PubChem CID 106106639) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 4-(methylaminomethyl)-N-[2-(1-methylpyrazol-3-yl)ethyl]piperidine-1-sulfonamide.
| Compound Name | 4-(methylaminomethyl)-N-[2-(1-methylpyrazol-3-yl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106106639 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-(methylaminomethyl)-N-[2-(1-methylpyrazol-3-yl)ethyl]piperidine-1-sulfonamide |
| SMILES | CNCC1CCN(S(=O)(=O)NCCc2ccn(C)n2)CC1 |
| InChI | InChI=1S/C13H25N5O2S/c1-14-11-12-4-9-18(10-5-12)21(19,20)15-7-3-13-6-8-17(2)16-13/h6,8,12,14-15H,3-5,7,9-11H2,1-2H3 |
| InChIKey | SMEUYGCNOALCPI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |