C9H13N3O4 — CID 106107325
2-methoxy-3-[(1-methylpyrazole-4-carbonyl)amino]propanoic acid (PubChem CID 106107325) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-methoxy-3-[(1-methylpyrazole-4-carbonyl)amino]propanoic acid.
| Compound Name | 2-methoxy-3-[(1-methylpyrazole-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 106107325 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-methoxy-3-[(1-methylpyrazole-4-carbonyl)amino]propanoic acid |
| SMILES | COC(CNC(=O)c1cnn(C)c1)C(=O)O |
| InChI | InChI=1S/C9H13N3O4/c1-12-5-6(3-11-12)8(13)10-4-7(16-2)9(14)15/h3,5,7H,4H2,1-2H3,(H,10,13)(H,14,15) |
| InChIKey | NMHCGLBZRKOLMP-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |