C9H13N3O4 — CID 103879149
methyl 2-hydroxy-3-[(1-methylpyrazole-4-carbonyl)amino]propanoate (PubChem CID 103879149) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(1-methylpyrazole-4-carbonyl)amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(1-methylpyrazole-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103879149 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | methyl 2-hydroxy-3-[(1-methylpyrazole-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C9H13N3O4/c1-12-5-6(3-11-12)8(14)10-4-7(13)9(15)16-2/h3,5,7,13H,4H2,1-2H3,(H,10,14) |
| InChIKey | MUWQDGWNEJSJBS-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |